C24H31Na2O7P — CID 10458924
disodium;[3-(3-methoxy-8'-propylspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridec-2(7)-ene]-3-yl)phenyl] phosphate (PubChem CID 10458924) has the molecular formula C24H31Na2O7P and a molecular weight of 508.46 g/mol. Its IUPAC name is disodium;[3-(3-methoxy-8'-propylspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridec-2(7)-ene]-3-yl)phenyl] phosphate.
| Compound Name | disodium;[3-(3-methoxy-8'-propylspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridec-2(7)-ene]-3-yl)phenyl] phosphate |
|---|---|
| PubChem CID | 10458924 |
| Molecular Formula | C24H31Na2O7P |
| Molecular Weight | 508.46 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | disodium;[3-(3-methoxy-8'-propylspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridec-2(7)-ene]-3-yl)phenyl] phosphate |
| SMILES | CCCC1C2=C(CCCC2)C2CCCC1C21OOC1(OC)c1cccc(OP(=O)([O-])[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C24H33O7P.2Na/c1-3-8-19-18-11-4-5-12-20(18)22-14-7-13-21(19)23(22)24(28-2,31-30-23)16-9-6-10-17(15-16)29-32(25,26)27;;/h6,9-10,15,19,21-22H,3-5,7-8,11-14H2,1-2H3,(H2,25,26,27);;/q;2*+1/p-2 |
| InChIKey | RFNJRLLFDPHVPU-UHFFFAOYSA-L |
| XLogP | -1.88 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.46 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|