About 4-bromo-2,3-dichloro-N-methylaniline
4-bromo-2,3-dichloro-N-methylaniline (PubChem CID 104589247) has the molecular formula C7H6BrCl2N
and a molecular weight of 254.94 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-methylaniline.
Molecular Properties
| Compound Name | 4-bromo-2,3-dichloro-N-methylaniline |
| PubChem CID | 104589247 |
| Molecular Formula | C7H6BrCl2N |
| Molecular Weight | 254.94 g/mol |
| Exact Mass | 252.91 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-methylaniline |
| SMILES | CNc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C7H6BrCl2N/c1-11-5-3-2-4(8)6(9)7(5)10/h2-3,11H,1H3 |
| InChIKey | QKWDKXNUSMGULY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.94 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,3-dichloro-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,3-dichloro-N-methylaniline?
The IUPAC name of 4-bromo-2,3-dichloro-N-methylaniline (CID 104589247) is 4-bromo-2,3-dichloro-N-methylaniline.
What is the SMILES notation for 4-bromo-2,3-dichloro-N-methylaniline?
The canonical SMILES for 4-bromo-2,3-dichloro-N-methylaniline is CNc1ccc(Br)c(Cl)c1Cl.
What is the InChIKey of 4-bromo-2,3-dichloro-N-methylaniline?
The InChIKey is QKWDKXNUSMGULY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrCl2N/c1-11-5-3-2-4(8)6(9)7(5)10/h2-3,11H,1H3.
What are the key properties of 4-bromo-2,3-dichloro-N-methylaniline?
4-bromo-2,3-dichloro-N-methylaniline has a molecular weight of 254.94 g/mol, XLogP of 3.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,3-dichloro-N-methylaniline is sourced from PubChem (CID 104589247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).