C27H52O5Si2 — CID 10459091
(1E,3R,4R,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-3-ol (PubChem CID 10459091) has the molecular formula C27H52O5Si2 and a molecular weight of 512.88 g/mol. Its IUPAC name is (1E,3R,4R,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-3-ol.
| Compound Name | (1E,3R,4R,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-3-ol |
|---|---|
| PubChem CID | 10459091 |
| Molecular Formula | C27H52O5Si2 |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | (1E,3R,4R,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-3-ol |
| SMILES | C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)/C=C/[C@@H]1OC(C)(C)O[C@H]1/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O5Si2/c1-14-16-22(32-34(12,13)26(5,6)7)21(28)18-19-24-23(30-27(8,9)31-24)17-15-20-29-33(10,11)25(2,3)4/h14-19,21-24,28H,20H2,1-13H3/b16-14+,17-15+,19-18+/t21-,22-,23+,24+/m1/s1 |
| InChIKey | WHEMUNHSBIDHEH-QZQYZKMWSA-N |
| XLogP | 6.97 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|