C14H16ClN3 — CID 104591315
6-chloro-2-N-(2-phenylpropyl)pyridine-2,3-diamine (PubChem CID 104591315) has the molecular formula C14H16ClN3 and a molecular weight of 261.76 g/mol. Its IUPAC name is 6-chloro-2-N-(2-phenylpropyl)pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-(2-phenylpropyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 104591315 |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6-chloro-2-N-(2-phenylpropyl)pyridine-2,3-diamine |
| SMILES | CC(CNc1nc(Cl)ccc1N)c1ccccc1 |
| InChI | InChI=1S/C14H16ClN3/c1-10(11-5-3-2-4-6-11)9-17-14-12(16)7-8-13(15)18-14/h2-8,10H,9,16H2,1H3,(H,17,18) |
| InChIKey | KVWYSZAWYVPDIH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|