C12H18N4O3 — CID 104592038
2-amino-N-(3,3-dimethylbutan-2-yl)-5-nitropyridine-3-carboxamide (PubChem CID 104592038) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-amino-N-(3,3-dimethylbutan-2-yl)-5-nitropyridine-3-carboxamide.
| Compound Name | 2-amino-N-(3,3-dimethylbutan-2-yl)-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 104592038 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-amino-N-(3,3-dimethylbutan-2-yl)-5-nitropyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1cc([N+](=O)[O-])cnc1N)C(C)(C)C |
| InChI | InChI=1S/C12H18N4O3/c1-7(12(2,3)4)15-11(17)9-5-8(16(18)19)6-14-10(9)13/h5-7H,1-4H3,(H2,13,14)(H,15,17) |
| InChIKey | LLKKIDWYYBAWDZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|