About 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile
1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile (PubChem CID 104593321) has the molecular formula C12H8N4OS
and a molecular weight of 256.29 g/mol. Its IUPAC name is 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile |
| PubChem CID | 104593321 |
| Molecular Formula | C12H8N4OS |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile |
| SMILES | Cn1cc(C#N)c(-n2sc3ccccc3c2=O)n1 |
| InChI | InChI=1S/C12H8N4OS/c1-15-7-8(6-13)11(14-15)16-12(17)9-4-2-3-5-10(9)18-16/h2-5,7H,1H3 |
| InChIKey | SDYRQMREJSBGSG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile?
The IUPAC name of 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile (CID 104593321) is 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile.
What is the SMILES notation for 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile?
The canonical SMILES for 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile is Cn1cc(C#N)c(-n2sc3ccccc3c2=O)n1.
What is the InChIKey of 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile?
The InChIKey is SDYRQMREJSBGSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4OS/c1-15-7-8(6-13)11(14-15)16-12(17)9-4-2-3-5-10(9)18-16/h2-5,7H,1H3.
What are the key properties of 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile?
1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile has a molecular weight of 256.29 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(3-oxo-1,2-benzothiazol-2-yl)pyrazole-4-carbonitrile is sourced from PubChem (CID 104593321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).