C15H24N2O2 — CID 104593635
2-(3,4-dimethylphenyl)-N-[2-(2-hydroxypropylamino)ethyl]acetamide (PubChem CID 104593635) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-[2-(2-hydroxypropylamino)ethyl]acetamide.
| Compound Name | 2-(3,4-dimethylphenyl)-N-[2-(2-hydroxypropylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 104593635 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-[2-(2-hydroxypropylamino)ethyl]acetamide |
| SMILES | Cc1ccc(CC(=O)NCCNCC(C)O)cc1C |
| InChI | InChI=1S/C15H24N2O2/c1-11-4-5-14(8-12(11)2)9-15(19)17-7-6-16-10-13(3)18/h4-5,8,13,16,18H,6-7,9-10H2,1-3H3,(H,17,19) |
| InChIKey | MLVRFPWOMKOTAB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|