C30H40N2O6 — CID 10459477
ethyl (1R,2E,4S,5R,9R,11S,12S)-1-methoxy-8,12-dimethyl-11-[(E)-3-(1-methylimidazol-4-yl)prop-2-enoyl]oxy-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-2-carboxylate (PubChem CID 10459477) has the molecular formula C30H40N2O6 and a molecular weight of 524.66 g/mol. Its IUPAC name is ethyl (1R,2E,4S,5R,9R,11S,12S)-1-methoxy-8,12-dimethyl-11-[(E)-3-(1-methylimidazol-4-yl)prop-2-enoyl]oxy-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-2-carboxylate.
| Compound Name | ethyl (1R,2E,4S,5R,9R,11S,12S)-1-methoxy-8,12-dimethyl-11-[(E)-3-(1-methylimidazol-4-yl)prop-2-enoyl]oxy-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-2-carboxylate |
|---|---|
| PubChem CID | 10459477 |
| Molecular Formula | C30H40N2O6 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | ethyl (1R,2E,4S,5R,9R,11S,12S)-1-methoxy-8,12-dimethyl-11-[(E)-3-(1-methylimidazol-4-yl)prop-2-enoyl]oxy-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-2-carboxylate |
| SMILES | CCOC(=O)/C1=C/[C@@H]2[C@@H](C(C)C)CC=C(C)[C@@H]2C[C@H](OC(=O)/C=C/c2cn(C)cn2)[C@]2(C)C=C[C@@]1(OC)O2 |
| InChI | InChI=1S/C30H40N2O6/c1-8-36-28(34)25-15-24-22(19(2)3)11-9-20(4)23(24)16-26(29(5)13-14-30(25,35-7)38-29)37-27(33)12-10-21-17-32(6)18-31-21/h9-10,12-15,17-19,22-24,26H,8,11,16H2,1-7H3/b12-10+,25-15-/t22-,23+,24-,26+,29+,30-/m1/s1 |
| InChIKey | QLJUEJCLXJTMEV-PFFRIHNDSA-N |
| XLogP | 4.78 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|