C16H17NO3 — CID 104595377
2-methyl-1-(3-phenylprop-2-ynoyl)piperidine-2-carboxylic acid (PubChem CID 104595377) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-methyl-1-(3-phenylprop-2-ynoyl)piperidine-2-carboxylic acid.
| Compound Name | 2-methyl-1-(3-phenylprop-2-ynoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 104595377 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-methyl-1-(3-phenylprop-2-ynoyl)piperidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCCN1C(=O)C#Cc1ccccc1 |
| InChI | InChI=1S/C16H17NO3/c1-16(15(19)20)11-5-6-12-17(16)14(18)10-9-13-7-3-2-4-8-13/h2-4,7-8H,5-6,11-12H2,1H3,(H,19,20) |
| InChIKey | OILDOOKFANMIII-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|