C14H20N2O3S — CID 104596315
3-[(2-methylpiperidine-2-carbonyl)amino]-3-thiophen-2-ylpropanoic acid (PubChem CID 104596315) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 3-[(2-methylpiperidine-2-carbonyl)amino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[(2-methylpiperidine-2-carbonyl)amino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 104596315 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-[(2-methylpiperidine-2-carbonyl)amino]-3-thiophen-2-ylpropanoic acid |
| SMILES | CC1(C(=O)NC(CC(=O)O)c2cccs2)CCCCN1 |
| InChI | InChI=1S/C14H20N2O3S/c1-14(6-2-3-7-15-14)13(19)16-10(9-12(17)18)11-5-4-8-20-11/h4-5,8,10,15H,2-3,6-7,9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | XGPCNOVLCMBJIS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |