C12H22N2O2 — CID 104596637
N-(3-ethenoxypropyl)-2-methylpiperidine-2-carboxamide (PubChem CID 104596637) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is N-(3-ethenoxypropyl)-2-methylpiperidine-2-carboxamide.
| Compound Name | N-(3-ethenoxypropyl)-2-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 104596637 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N-(3-ethenoxypropyl)-2-methylpiperidine-2-carboxamide |
| SMILES | C=COCCCNC(=O)C1(C)CCCCN1 |
| InChI | InChI=1S/C12H22N2O2/c1-3-16-10-6-8-13-11(15)12(2)7-4-5-9-14-12/h3,14H,1,4-10H2,2H3,(H,13,15) |
| InChIKey | MZAXRANOTCRZLF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|