C24H19N5O6S2 — CID 10459855
N-(2-amino-2-oxoethyl)-3-(1-benzyl-2,4-dioxoquinolin-3-yl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazine-7-carboxamide (PubChem CID 10459855) has the molecular formula C24H19N5O6S2 and a molecular weight of 537.58 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-(1-benzyl-2,4-dioxoquinolin-3-yl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-(1-benzyl-2,4-dioxoquinolin-3-yl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 10459855 |
| Molecular Formula | C24H19N5O6S2 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-(1-benzyl-2,4-dioxoquinolin-3-yl)-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazine-7-carboxamide |
| SMILES | NC(=O)CNC(=O)c1csc2c1S(=O)(=O)N=C(C1C(=O)c3ccccc3N(Cc3ccccc3)C1=O)N2 |
| InChI | InChI=1S/C24H19N5O6S2/c25-17(30)10-26-22(32)15-12-36-23-20(15)37(34,35)28-21(27-23)18-19(31)14-8-4-5-9-16(14)29(24(18)33)11-13-6-2-1-3-7-13/h1-9,12,18H,10-11H2,(H2,25,30)(H,26,32)(H,27,28) |
| InChIKey | FIYHIUHSEUINAG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|