C31H54O7 — CID 10459900
(5R)-5-[(10S)-10-hydroxy-11-[2-[(2R)-2-hydroxyundecoxy]ethoxy]undec-8-ynyl]-3-(2-oxopropyl)oxolan-2-one (PubChem CID 10459900) has the molecular formula C31H54O7 and a molecular weight of 538.77 g/mol. Its IUPAC name is (5R)-5-[(10S)-10-hydroxy-11-[2-[(2R)-2-hydroxyundecoxy]ethoxy]undec-8-ynyl]-3-(2-oxopropyl)oxolan-2-one.
| Compound Name | (5R)-5-[(10S)-10-hydroxy-11-[2-[(2R)-2-hydroxyundecoxy]ethoxy]undec-8-ynyl]-3-(2-oxopropyl)oxolan-2-one |
|---|---|
| PubChem CID | 10459900 |
| Molecular Formula | C31H54O7 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.39 |
| IUPAC Name | (5R)-5-[(10S)-10-hydroxy-11-[2-[(2R)-2-hydroxyundecoxy]ethoxy]undec-8-ynyl]-3-(2-oxopropyl)oxolan-2-one |
| SMILES | CCCCCCCCC[C@@H](O)COCCOC[C@@H](O)C#CCCCCCCC[C@@H]1CC(CC(C)=O)C(=O)O1 |
| InChI | InChI=1S/C31H54O7/c1-3-4-5-6-8-11-14-17-28(33)24-36-20-21-37-25-29(34)18-15-12-9-7-10-13-16-19-30-23-27(22-26(2)32)31(35)38-30/h27-30,33-34H,3-14,16-17,19-25H2,1-2H3/t27?,28-,29+,30-/m1/s1 |
| InChIKey | GDARJSGQHFQVPG-BCVVUZKJSA-N |
| XLogP | 5.53 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|