C26H22F7N3O2 — CID 10459957
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-8-(4-fluorophenyl)-N,6-dimethyl-5-oxo-1,2,3,4-tetrahydro-1,6-naphthyridine-7-carboxamide (PubChem CID 10459957) has the molecular formula C26H22F7N3O2 and a molecular weight of 541.47 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-8-(4-fluorophenyl)-N,6-dimethyl-5-oxo-1,2,3,4-tetrahydro-1,6-naphthyridine-7-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-8-(4-fluorophenyl)-N,6-dimethyl-5-oxo-1,2,3,4-tetrahydro-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 10459957 |
| Molecular Formula | C26H22F7N3O2 |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-8-(4-fluorophenyl)-N,6-dimethyl-5-oxo-1,2,3,4-tetrahydro-1,6-naphthyridine-7-carboxamide |
| SMILES | CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)c1c(-c2ccc(F)cc2)c2c(c(=O)n1C)CCCN2 |
| InChI | InChI=1S/C26H22F7N3O2/c1-35(13-14-10-16(25(28,29)30)12-17(11-14)26(31,32)33)24(38)22-20(15-5-7-18(27)8-6-15)21-19(4-3-9-34-21)23(37)36(22)2/h5-8,10-12,34H,3-4,9,13H2,1-2H3 |
| InChIKey | USWPBWNYRGTTKA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |