C11H13N3S — CID 104599802
5-ethyl-N-(pyridin-3-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 104599802) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 5-ethyl-N-(pyridin-3-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-ethyl-N-(pyridin-3-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 104599802 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-ethyl-N-(pyridin-3-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | CCc1cnc(NCc2cccnc2)s1 |
| InChI | InChI=1S/C11H13N3S/c1-2-10-8-14-11(15-10)13-7-9-4-3-5-12-6-9/h3-6,8H,2,7H2,1H3,(H,13,14) |
| InChIKey | FAHZVYSYXJICGZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |