C32H56O3Si2 — CID 10460060
(6R)-6-[(2E,4E,6E,8E)-6-methyl-8-(2,6,6-trimethylcyclohex-2-en-1-ylidene)octa-2,4,6-trien-2-yl]-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilepane (PubChem CID 10460060) has the molecular formula C32H56O3Si2 and a molecular weight of 544.97 g/mol. Its IUPAC name is (6R)-6-[(2E,4E,6E,8E)-6-methyl-8-(2,6,6-trimethylcyclohex-2-en-1-ylidene)octa-2,4,6-trien-2-yl]-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilepane.
| Compound Name | (6R)-6-[(2E,4E,6E,8E)-6-methyl-8-(2,6,6-trimethylcyclohex-2-en-1-ylidene)octa-2,4,6-trien-2-yl]-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilepane |
|---|---|
| PubChem CID | 10460060 |
| Molecular Formula | C32H56O3Si2 |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | (6R)-6-[(2E,4E,6E,8E)-6-methyl-8-(2,6,6-trimethylcyclohex-2-en-1-ylidene)octa-2,4,6-trien-2-yl]-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilepane |
| SMILES | CC1=CCCC(C)(C)/C1=C\C=C(C)\C=C\C=C(/C)[C@@H]1CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C32H56O3Si2/c1-23(2)36(24(3)4)33-22-31(34-37(35-36,25(5)6)26(7)8)29(11)17-14-16-27(9)19-20-30-28(10)18-15-21-32(30,12)13/h14,16-20,23-26,31H,15,21-22H2,1-13H3/b16-14+,27-19+,29-17+,30-20-/t31-/m0/s1 |
| InChIKey | VFAREAXGTNYFKE-HVZKMHEYSA-N |
| XLogP | 10.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|