C12H15N3S — CID 104601805
5-[(2,5-dimethylphenyl)methyl]-2-methyl-1H-1,2,4-triazole-3-thione (PubChem CID 104601805) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 5-[(2,5-dimethylphenyl)methyl]-2-methyl-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-[(2,5-dimethylphenyl)methyl]-2-methyl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 104601805 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 5-[(2,5-dimethylphenyl)methyl]-2-methyl-1H-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(C)c(Cc2nc(=S)n(C)[nH]2)c1 |
| InChI | InChI=1S/C12H15N3S/c1-8-4-5-9(2)10(6-8)7-11-13-12(16)15(3)14-11/h4-6H,7H2,1-3H3,(H,13,14,16) |
| InChIKey | GRVOOJZUKMKVAA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|