C13H17N3O2S — CID 104601830
5-(3,4-diethoxyphenyl)-2-methyl-1H-1,2,4-triazole-3-thione (PubChem CID 104601830) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 5-(3,4-diethoxyphenyl)-2-methyl-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-(3,4-diethoxyphenyl)-2-methyl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 104601830 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 5-(3,4-diethoxyphenyl)-2-methyl-1H-1,2,4-triazole-3-thione |
| SMILES | CCOc1ccc(-c2nc(=S)n(C)[nH]2)cc1OCC |
| InChI | InChI=1S/C13H17N3O2S/c1-4-17-10-7-6-9(8-11(10)18-5-2)12-14-13(19)16(3)15-12/h6-8H,4-5H2,1-3H3,(H,14,15,19) |
| InChIKey | BXHKNVNLFLHDDS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|