C34H38N4O3 — CID 10460238
(3S,6S)-6-(4-aminobutyl)-1-[[4-[4-(dimethylamino)phenoxy]phenyl]methyl]-3-(naphthalen-2-ylmethyl)piperazine-2,5-dione (PubChem CID 10460238) has the molecular formula C34H38N4O3 and a molecular weight of 550.70 g/mol. Its IUPAC name is (3S,6S)-6-(4-aminobutyl)-1-[[4-[4-(dimethylamino)phenoxy]phenyl]methyl]-3-(naphthalen-2-ylmethyl)piperazine-2,5-dione.
| Compound Name | (3S,6S)-6-(4-aminobutyl)-1-[[4-[4-(dimethylamino)phenoxy]phenyl]methyl]-3-(naphthalen-2-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 10460238 |
| Molecular Formula | C34H38N4O3 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | (3S,6S)-6-(4-aminobutyl)-1-[[4-[4-(dimethylamino)phenoxy]phenyl]methyl]-3-(naphthalen-2-ylmethyl)piperazine-2,5-dione |
| SMILES | CN(C)c1ccc(Oc2ccc(CN3C(=O)[C@H](Cc4ccc5ccccc5c4)NC(=O)[C@@H]3CCCCN)cc2)cc1 |
| InChI | InChI=1S/C34H38N4O3/c1-37(2)28-14-18-30(19-15-28)41-29-16-11-24(12-17-29)23-38-32(9-5-6-20-35)33(39)36-31(34(38)40)22-25-10-13-26-7-3-4-8-27(26)21-25/h3-4,7-8,10-19,21,31-32H,5-6,9,20,22-23,35H2,1-2H3,(H,36,39)/t31-,32-/m0/s1 |
| InChIKey | OEWBKJKUPKACIW-ACHIHNKUSA-N |
| XLogP | 5.27 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|