About 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline
3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline (PubChem CID 104602844) has the molecular formula C10H12N4OS
and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline.
Molecular Properties
| Compound Name | 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline |
| PubChem CID | 104602844 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline |
| SMILES | COc1cc(N)cc(Sc2ncnn2C)c1 |
| InChI | InChI=1S/C10H12N4OS/c1-14-10(12-6-13-14)16-9-4-7(11)3-8(5-9)15-2/h3-6H,11H2,1-2H3 |
| InChIKey | GVULGUHZEUEPOV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline?
The IUPAC name of 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline (CID 104602844) is 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline.
What is the SMILES notation for 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline?
The canonical SMILES for 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline is COc1cc(N)cc(Sc2ncnn2C)c1.
What is the InChIKey of 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline?
The InChIKey is GVULGUHZEUEPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4OS/c1-14-10(12-6-13-14)16-9-4-7(11)3-8(5-9)15-2/h3-6H,11H2,1-2H3.
What are the key properties of 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline?
3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline has a molecular weight of 236.30 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]aniline is sourced from PubChem (CID 104602844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).