About 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide
2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 104603075) has the molecular formula C10H8F3N5OS
and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| PubChem CID | 104603075 |
| Molecular Formula | C10H8F3N5OS |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Cn1ncnc1Sc1nc(C(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C10H8F3N5OS/c1-18-9(15-4-16-18)20-8-5(7(14)19)2-3-6(17-8)10(11,12)13/h2-4H,1H3,(H2,14,19) |
| InChIKey | UTKQLYCGTDANLX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The IUPAC name of 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide (CID 104603075) is 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
What is the SMILES notation for 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The canonical SMILES for 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide is Cn1ncnc1Sc1nc(C(F)(F)F)ccc1C(N)=O.
What is the InChIKey of 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The InChIKey is UTKQLYCGTDANLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N5OS/c1-18-9(15-4-16-18)20-8-5(7(14)19)2-3-6(17-8)10(11,12)13/h2-4H,1H3,(H2,14,19).
What are the key properties of 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide has a molecular weight of 303.27 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide is sourced from PubChem (CID 104603075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).