C28H40N6O6 — CID 10460365
2-[[2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetyl]-methylamino]-3-phenylpropanoyl]amino]-N,N-dimethylethanamine oxide (PubChem CID 10460365) has the molecular formula C28H40N6O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is 2-[[2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetyl]-methylamino]-3-phenylpropanoyl]amino]-N,N-dimethylethanamine oxide.
| Compound Name | 2-[[2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetyl]-methylamino]-3-phenylpropanoyl]amino]-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 10460365 |
| Molecular Formula | C28H40N6O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 2-[[2-[[2-[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]acetyl]-methylamino]-3-phenylpropanoyl]amino]-N,N-dimethylethanamine oxide |
| SMILES | CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NCC(=O)N(C)C(Cc1ccccc1)C(=O)NCC[N+](C)(C)[O-] |
| InChI | InChI=1S/C28H40N6O6/c1-19(32-27(38)23(29)16-21-10-12-22(35)13-11-21)26(37)31-18-25(36)33(2)24(17-20-8-6-5-7-9-20)28(39)30-14-15-34(3,4)40/h5-13,19,23-24,35H,14-18,29H2,1-4H3,(H,30,39)(H,31,37)(H,32,38) |
| InChIKey | WSINTTQUZKUMIA-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 176.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|