C8H14N4S — CID 104603698
3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]piperidine (PubChem CID 104603698) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]piperidine.
| Compound Name | 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]piperidine |
|---|---|
| PubChem CID | 104603698 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]piperidine |
| SMILES | Cn1ncnc1SC1CCCNC1 |
| InChI | InChI=1S/C8H14N4S/c1-12-8(10-6-11-12)13-7-3-2-4-9-5-7/h6-7,9H,2-5H2,1H3 |
| InChIKey | UWZVYOTXJJFKTO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |