About 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile
2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile (PubChem CID 104603757) has the molecular formula C12H21N5S
and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile.
Molecular Properties
| Compound Name | 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile |
| PubChem CID | 104603757 |
| Molecular Formula | C12H21N5S |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile |
| SMILES | CCCNC(C)(C#N)CC(C)Sc1ncnn1C |
| InChI | InChI=1S/C12H21N5S/c1-5-6-15-12(3,8-13)7-10(2)18-11-14-9-16-17(11)4/h9-10,15H,5-7H2,1-4H3 |
| InChIKey | BIDMSDBSAGSVJQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile?
The IUPAC name of 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile (CID 104603757) is 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile.
What is the SMILES notation for 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile?
The canonical SMILES for 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile is CCCNC(C)(C#N)CC(C)Sc1ncnn1C.
What is the InChIKey of 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile?
The InChIKey is BIDMSDBSAGSVJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5S/c1-5-6-15-12(3,8-13)7-10(2)18-11-14-9-16-17(11)4/h9-10,15H,5-7H2,1-4H3.
What are the key properties of 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile?
2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile has a molecular weight of 267.40 g/mol, XLogP of 1.97, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-(propylamino)pentanenitrile is sourced from PubChem (CID 104603757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).