About 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde
4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde (PubChem CID 104604242) has the molecular formula C10H8BrN3OS
and a molecular weight of 298.17 g/mol. Its IUPAC name is 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde.
Molecular Properties
| Compound Name | 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde |
| PubChem CID | 104604242 |
| Molecular Formula | C10H8BrN3OS |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde |
| SMILES | Cn1ncnc1Sc1cc(Br)ccc1C=O |
| InChI | InChI=1S/C10H8BrN3OS/c1-14-10(12-6-13-14)16-9-4-8(11)3-2-7(9)5-15/h2-6H,1H3 |
| InChIKey | JKVIYMAGRXSUTI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde?
The IUPAC name of 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde (CID 104604242) is 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde.
What is the SMILES notation for 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde?
The canonical SMILES for 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde is Cn1ncnc1Sc1cc(Br)ccc1C=O.
What is the InChIKey of 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde?
The InChIKey is JKVIYMAGRXSUTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrN3OS/c1-14-10(12-6-13-14)16-9-4-8(11)3-2-7(9)5-15/h2-6H,1H3.
What are the key properties of 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde?
4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde has a molecular weight of 298.17 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]benzaldehyde is sourced from PubChem (CID 104604242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).