About 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine
4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine (PubChem CID 104604869) has the molecular formula C8H9N5S
and a molecular weight of 207.26 g/mol. Its IUPAC name is 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine |
| PubChem CID | 104604869 |
| Molecular Formula | C8H9N5S |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine |
| SMILES | Cn1ncnc1Sc1ccnc(N)c1 |
| InChI | InChI=1S/C8H9N5S/c1-13-8(11-5-12-13)14-6-2-3-10-7(9)4-6/h2-5H,1H3,(H2,9,10) |
| InChIKey | QHAVNLZTEVSTRZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine?
The IUPAC name of 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine (CID 104604869) is 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine.
What is the SMILES notation for 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine?
The canonical SMILES for 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine is Cn1ncnc1Sc1ccnc(N)c1.
What is the InChIKey of 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine?
The InChIKey is QHAVNLZTEVSTRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5S/c1-13-8(11-5-12-13)14-6-2-3-10-7(9)4-6/h2-5H,1H3,(H2,9,10).
What are the key properties of 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine?
4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine has a molecular weight of 207.26 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]pyridin-2-amine is sourced from PubChem (CID 104604869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).