C12H21N5 — CID 104605561
5-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-methyl-1,2,4-triazol-3-amine (PubChem CID 104605561) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 5-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 104605561 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 5-(1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)-2-methyl-1,2,4-triazol-3-amine |
| SMILES | Cn1nc(C2CCC3CCCCC3N2)nc1N |
| InChI | InChI=1S/C12H21N5/c1-17-12(13)15-11(16-17)10-7-6-8-4-2-3-5-9(8)14-10/h8-10,14H,2-7H2,1H3,(H2,13,15,16) |
| InChIKey | WECGAFOZZXBLBD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |