C11H16FN3O2 — CID 104605946
3-[(5-fluoropyrimidin-2-yl)amino]-2,2,3-trimethylbutanoic acid (PubChem CID 104605946) has the molecular formula C11H16FN3O2 and a molecular weight of 241.27 g/mol. Its IUPAC name is 3-[(5-fluoropyrimidin-2-yl)amino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[(5-fluoropyrimidin-2-yl)amino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 104605946 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-[(5-fluoropyrimidin-2-yl)amino]-2,2,3-trimethylbutanoic acid |
| SMILES | CC(C)(Nc1ncc(F)cn1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C11H16FN3O2/c1-10(2,8(16)17)11(3,4)15-9-13-5-7(12)6-14-9/h5-6H,1-4H3,(H,16,17)(H,13,14,15) |
| InChIKey | CKTCDQNFTJBSTG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |