C10H17FN4 — CID 104606344
2-N-(5-fluoropyrimidin-2-yl)-4-methylpentane-1,2-diamine (PubChem CID 104606344) has the molecular formula C10H17FN4 and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-N-(5-fluoropyrimidin-2-yl)-4-methylpentane-1,2-diamine.
| Compound Name | 2-N-(5-fluoropyrimidin-2-yl)-4-methylpentane-1,2-diamine |
|---|---|
| PubChem CID | 104606344 |
| Molecular Formula | C10H17FN4 |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-N-(5-fluoropyrimidin-2-yl)-4-methylpentane-1,2-diamine |
| SMILES | CC(C)CC(CN)Nc1ncc(F)cn1 |
| InChI | InChI=1S/C10H17FN4/c1-7(2)3-9(4-12)15-10-13-5-8(11)6-14-10/h5-7,9H,3-4,12H2,1-2H3,(H,13,14,15) |
| InChIKey | GZAQLAGAGNQWEL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |