C14H15FN4 — CID 104606437
N-[(4-aminophenyl)methyl]-N-cyclopropyl-5-fluoropyrimidin-2-amine (PubChem CID 104606437) has the molecular formula C14H15FN4 and a molecular weight of 258.30 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-N-cyclopropyl-5-fluoropyrimidin-2-amine.
| Compound Name | N-[(4-aminophenyl)methyl]-N-cyclopropyl-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 104606437 |
| Molecular Formula | C14H15FN4 |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-N-cyclopropyl-5-fluoropyrimidin-2-amine |
| SMILES | Nc1ccc(CN(c2ncc(F)cn2)C2CC2)cc1 |
| InChI | InChI=1S/C14H15FN4/c15-11-7-17-14(18-8-11)19(13-5-6-13)9-10-1-3-12(16)4-2-10/h1-4,7-8,13H,5-6,9,16H2 |
| InChIKey | HBNYVOQIAUMCCO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|