C11H16ClFN4 — CID 104606670
1-(2-chloroethyl)-4-(5-fluoropyrimidin-2-yl)-1,4-diazepane (PubChem CID 104606670) has the molecular formula C11H16ClFN4 and a molecular weight of 258.73 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-(5-fluoropyrimidin-2-yl)-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-(5-fluoropyrimidin-2-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 104606670 |
| Molecular Formula | C11H16ClFN4 |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-(2-chloroethyl)-4-(5-fluoropyrimidin-2-yl)-1,4-diazepane |
| SMILES | Fc1cnc(N2CCCN(CCCl)CC2)nc1 |
| InChI | InChI=1S/C11H16ClFN4/c12-2-5-16-3-1-4-17(7-6-16)11-14-8-10(13)9-15-11/h8-9H,1-7H2 |
| InChIKey | VITCTFNSGDYBKQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|