5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid

C13H17NO4 — CID 104607104

IUPAC5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid
SMILESCC1CC(C)CN(C(=O)c2cc(C(=O)O)co2)C1
InChIInChI=1S/C13H17NO4/c1-8-3-9(2)6-14(5-8)12(15)11-4-10(7-18-11)13(16)17/h4,7-9H,3,5-6H2,1-2H3,(H,16,17)
InChIKeyFRSFQDDNVISZAD-UHFFFAOYSA-N
MW251.28 g/mol
LogP2.10
Rot. Bonds2

About 5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid

5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid (PubChem CID 104607104) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid.

Molecular Properties

Compound Name5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid
PubChem CID104607104
Molecular FormulaC13H17NO4
Molecular Weight251.28 g/mol
Exact Mass251.12
IUPAC Name5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid
SMILESCC1CC(C)CN(C(=O)c2cc(C(=O)O)co2)C1
InChIInChI=1S/C13H17NO4/c1-8-3-9(2)6-14(5-8)12(15)11-4-10(7-18-11)13(16)17/h4,7-9H,3,5-6H2,1-2H3,(H,16,17)
InChIKeyFRSFQDDNVISZAD-UHFFFAOYSA-N
XLogP2.10
TPSA70.75 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.28
LogP ≤ 52.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid?
The IUPAC name of 5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid (CID 104607104) is 5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid.
What is the SMILES notation for 5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid?
The canonical SMILES for 5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid is CC1CC(C)CN(C(=O)c2cc(C(=O)O)co2)C1.
What is the InChIKey of 5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid?
The InChIKey is FRSFQDDNVISZAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-8-3-9(2)6-14(5-8)12(15)11-4-10(7-18-11)13(16)17/h4,7-9H,3,5-6H2,1-2H3,(H,16,17).
What are the key properties of 5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid?
5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid has a molecular weight of 251.28 g/mol, XLogP of 2.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dimethylpiperidine-1-carbonyl)furan-3-carboxylic acid is sourced from PubChem (CID 104607104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).