C12H17NO4 — CID 104607143
5-[ethyl(2-methylpropyl)carbamoyl]furan-3-carboxylic acid (PubChem CID 104607143) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 5-[ethyl(2-methylpropyl)carbamoyl]furan-3-carboxylic acid.
| Compound Name | 5-[ethyl(2-methylpropyl)carbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104607143 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 5-[ethyl(2-methylpropyl)carbamoyl]furan-3-carboxylic acid |
| SMILES | CCN(CC(C)C)C(=O)c1cc(C(=O)O)co1 |
| InChI | InChI=1S/C12H17NO4/c1-4-13(6-8(2)3)11(14)10-5-9(7-17-10)12(15)16/h5,7-8H,4,6H2,1-3H3,(H,15,16) |
| InChIKey | NNPVWWRTNPJCEB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |