C33H45NO6Si — CID 10460850
(4S)-3-[(Z,4S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpent-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 10460850) has the molecular formula C33H45NO6Si and a molecular weight of 579.81 g/mol. Its IUPAC name is (4S)-3-[(Z,4S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpent-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(Z,4S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpent-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10460850 |
| Molecular Formula | C33H45NO6Si |
| Molecular Weight | 579.81 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | (4S)-3-[(Z,4S,5S)-5-[tert-butyl(diphenyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpent-2-enoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1COC(=O)N1C(=O)/C=C\[C@H](C)[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C33H45NO6Si/c1-23(2)27-21-37-31(36)34(27)29(35)20-19-24(3)30(28-22-38-33(7,8)39-28)40-41(32(4,5)6,25-15-11-9-12-16-25)26-17-13-10-14-18-26/h9-20,23-24,27-28,30H,21-22H2,1-8H3/b20-19-/t24-,27+,28+,30-/m0/s1 |
| InChIKey | QXEJVGHIFNIACU-DWCSSLPTSA-N |
| XLogP | 5.28 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.81 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|