C26H24ClF4N3O6 — CID 10460964
3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-N-ethoxy-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanamide (PubChem CID 10460964) has the molecular formula C26H24ClF4N3O6 and a molecular weight of 585.94 g/mol. Its IUPAC name is 3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-N-ethoxy-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanamide.
| Compound Name | 3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-N-ethoxy-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanamide |
|---|---|
| PubChem CID | 10460964 |
| Molecular Formula | C26H24ClF4N3O6 |
| Molecular Weight | 585.94 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | 3-[[(2S)-2-(7-chloro-1-oxoisoquinolin-2-yl)butanoyl]amino]-N-ethoxy-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanamide |
| SMILES | CCONC(=O)CC(NC(=O)[C@H](CC)n1ccc2ccc(Cl)cc2c1=O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C26H24ClF4N3O6/c1-3-19(34-8-7-13-5-6-14(27)9-15(13)26(34)38)25(37)32-18(11-21(36)33-40-4-2)20(35)12-39-24-22(30)16(28)10-17(29)23(24)31/h5-10,18-19H,3-4,11-12H2,1-2H3,(H,32,37)(H,33,36)/t18?,19-/m0/s1 |
| InChIKey | LYTKRTTUYZCHOH-GGYWPGCISA-N |
| XLogP | 3.75 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.94 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|