C12H19N3O3 — CID 104609675
2-[3-(1-methoxycyclopentyl)-1,2,4-oxadiazol-5-yl]morpholine (PubChem CID 104609675) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-[3-(1-methoxycyclopentyl)-1,2,4-oxadiazol-5-yl]morpholine.
| Compound Name | 2-[3-(1-methoxycyclopentyl)-1,2,4-oxadiazol-5-yl]morpholine |
|---|---|
| PubChem CID | 104609675 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-[3-(1-methoxycyclopentyl)-1,2,4-oxadiazol-5-yl]morpholine |
| SMILES | COC1(c2noc(C3CNCCO3)n2)CCCC1 |
| InChI | InChI=1S/C12H19N3O3/c1-16-12(4-2-3-5-12)11-14-10(18-15-11)9-8-13-6-7-17-9/h9,13H,2-8H2,1H3 |
| InChIKey | GUMOOMSYFKKEII-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |