C8H13N3OS — CID 104609899
3-(1-methoxycyclopentyl)-1,2,4-thiadiazol-5-amine (PubChem CID 104609899) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 3-(1-methoxycyclopentyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(1-methoxycyclopentyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 104609899 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-(1-methoxycyclopentyl)-1,2,4-thiadiazol-5-amine |
| SMILES | COC1(c2nsc(N)n2)CCCC1 |
| InChI | InChI=1S/C8H13N3OS/c1-12-8(4-2-3-5-8)6-10-7(9)13-11-6/h2-5H2,1H3,(H2,9,10,11) |
| InChIKey | ZVVWKJGZAKXEDL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |