C10H13IN2O3 — CID 104609921
4-hydroxy-5-iodo-2-(1-methoxycyclopentyl)-1H-pyrimidin-6-one (PubChem CID 104609921) has the molecular formula C10H13IN2O3 and a molecular weight of 336.13 g/mol. Its IUPAC name is 4-hydroxy-5-iodo-2-(1-methoxycyclopentyl)-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-5-iodo-2-(1-methoxycyclopentyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 104609921 |
| Molecular Formula | C10H13IN2O3 |
| Molecular Weight | 336.13 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 4-hydroxy-5-iodo-2-(1-methoxycyclopentyl)-1H-pyrimidin-6-one |
| SMILES | COC1(c2nc(O)c(I)c(=O)[nH]2)CCCC1 |
| InChI | InChI=1S/C10H13IN2O3/c1-16-10(4-2-3-5-10)9-12-7(14)6(11)8(15)13-9/h2-5H2,1H3,(H2,12,13,14,15) |
| InChIKey | XOBVCDISTLQALS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.13 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|