C12H20N2O2 — CID 104610403
1-(1-methoxycyclopentyl)-2-(1-methylpyrazol-3-yl)ethanol (PubChem CID 104610403) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(1-methoxycyclopentyl)-2-(1-methylpyrazol-3-yl)ethanol.
| Compound Name | 1-(1-methoxycyclopentyl)-2-(1-methylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 104610403 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 1-(1-methoxycyclopentyl)-2-(1-methylpyrazol-3-yl)ethanol |
| SMILES | COC1(C(O)Cc2ccn(C)n2)CCCC1 |
| InChI | InChI=1S/C12H20N2O2/c1-14-8-5-10(13-14)9-11(15)12(16-2)6-3-4-7-12/h5,8,11,15H,3-4,6-7,9H2,1-2H3 |
| InChIKey | ALYZPYNGYFRWJA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |