C30H44O10Si — CID 10461086
[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-bis(methoxymethoxy)phenyl]-[2-(1,3-dioxan-2-yl)-6-(methoxymethoxy)phenyl]methanone (PubChem CID 10461086) has the molecular formula C30H44O10Si and a molecular weight of 592.76 g/mol. Its IUPAC name is [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-bis(methoxymethoxy)phenyl]-[2-(1,3-dioxan-2-yl)-6-(methoxymethoxy)phenyl]methanone.
| Compound Name | [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-bis(methoxymethoxy)phenyl]-[2-(1,3-dioxan-2-yl)-6-(methoxymethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 10461086 |
| Molecular Formula | C30H44O10Si |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | [4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,6-bis(methoxymethoxy)phenyl]-[2-(1,3-dioxan-2-yl)-6-(methoxymethoxy)phenyl]methanone |
| SMILES | COCOc1cc(CO[Si](C)(C)C(C)(C)C)cc(OCOC)c1C(=O)c1c(OCOC)cccc1C1OCCCO1 |
| InChI | InChI=1S/C30H44O10Si/c1-30(2,3)41(7,8)40-17-21-15-24(38-19-33-5)27(25(16-21)39-20-34-6)28(31)26-22(29-35-13-10-14-36-29)11-9-12-23(26)37-18-32-4/h9,11-12,15-16,29H,10,13-14,17-20H2,1-8H3 |
| InChIKey | YTAYTFKHVXIAKS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|