C15H24IN3O — CID 104611744
6-ethyl-5-iodo-2-(1-methoxycyclopentyl)-N-propylpyrimidin-4-amine (PubChem CID 104611744) has the molecular formula C15H24IN3O and a molecular weight of 389.28 g/mol. Its IUPAC name is 6-ethyl-5-iodo-2-(1-methoxycyclopentyl)-N-propylpyrimidin-4-amine.
| Compound Name | 6-ethyl-5-iodo-2-(1-methoxycyclopentyl)-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 104611744 |
| Molecular Formula | C15H24IN3O |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 6-ethyl-5-iodo-2-(1-methoxycyclopentyl)-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(C2(OC)CCCC2)nc(CC)c1I |
| InChI | InChI=1S/C15H24IN3O/c1-4-10-17-13-12(16)11(5-2)18-14(19-13)15(20-3)8-6-7-9-15/h4-10H2,1-3H3,(H,17,18,19) |
| InChIKey | GWECUHIOYKUTFQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|