C11H18N4O — CID 104612085
4-ethyl-6-(1-methoxycyclopentyl)-1,3,5-triazin-2-amine (PubChem CID 104612085) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-ethyl-6-(1-methoxycyclopentyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethyl-6-(1-methoxycyclopentyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 104612085 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 4-ethyl-6-(1-methoxycyclopentyl)-1,3,5-triazin-2-amine |
| SMILES | CCc1nc(N)nc(C2(OC)CCCC2)n1 |
| InChI | InChI=1S/C11H18N4O/c1-3-8-13-9(15-10(12)14-8)11(16-2)6-4-5-7-11/h3-7H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | CHFSKEQINKNRTN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |