C35H43N3O6 — CID 10461222
benzyl N-[(2S)-1-[[(2S)-1-[[(4S)-6-methyl-2,3-dioxoheptan-4-yl]amino]-1-oxohexan-2-yl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamate (PubChem CID 10461222) has the molecular formula C35H43N3O6 and a molecular weight of 601.74 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-1-[[(4S)-6-methyl-2,3-dioxoheptan-4-yl]amino]-1-oxohexan-2-yl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-1-[[(4S)-6-methyl-2,3-dioxoheptan-4-yl]amino]-1-oxohexan-2-yl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10461222 |
| Molecular Formula | C35H43N3O6 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-1-[[(4S)-6-methyl-2,3-dioxoheptan-4-yl]amino]-1-oxohexan-2-yl]amino]-3-naphthalen-1-yl-1-oxopropan-2-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)C(C)=O |
| InChI | InChI=1S/C35H43N3O6/c1-5-6-19-29(33(41)37-30(20-23(2)3)32(40)24(4)39)36-34(42)31(38-35(43)44-22-25-13-8-7-9-14-25)21-27-17-12-16-26-15-10-11-18-28(26)27/h7-18,23,29-31H,5-6,19-22H2,1-4H3,(H,36,42)(H,37,41)(H,38,43)/t29-,30-,31-/m0/s1 |
| InChIKey | BJSWRBRXQRPAQW-CHQNGUEUSA-N |
| XLogP | 5.04 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|