C17H18N2O — CID 104612277
1-[2-amino-5-(2,3-dihydro-1H-inden-5-ylamino)phenyl]ethanone (PubChem CID 104612277) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[2-amino-5-(2,3-dihydro-1H-inden-5-ylamino)phenyl]ethanone.
| Compound Name | 1-[2-amino-5-(2,3-dihydro-1H-inden-5-ylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 104612277 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-[2-amino-5-(2,3-dihydro-1H-inden-5-ylamino)phenyl]ethanone |
| SMILES | CC(=O)c1cc(Nc2ccc3c(c2)CCC3)ccc1N |
| InChI | InChI=1S/C17H18N2O/c1-11(20)16-10-15(7-8-17(16)18)19-14-6-5-12-3-2-4-13(12)9-14/h5-10,19H,2-4,18H2,1H3 |
| InChIKey | MJBCDBKROPDIQL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|