C38H50F2N2O2 — CID 10461282
[4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]-(3,5-ditert-butyl-4-methoxyphenyl)methanone (PubChem CID 10461282) has the molecular formula C38H50F2N2O2 and a molecular weight of 604.83 g/mol. Its IUPAC name is [4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]-(3,5-ditert-butyl-4-methoxyphenyl)methanone.
| Compound Name | [4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]-(3,5-ditert-butyl-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 10461282 |
| Molecular Formula | C38H50F2N2O2 |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | [4-[6,6-bis(4-fluorophenyl)hexyl]piperazin-1-yl]-(3,5-ditert-butyl-4-methoxyphenyl)methanone |
| SMILES | COc1c(C(C)(C)C)cc(C(=O)N2CCN(CCCCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1C(C)(C)C |
| InChI | InChI=1S/C38H50F2N2O2/c1-37(2,3)33-25-29(26-34(35(33)44-7)38(4,5)6)36(43)42-23-21-41(22-24-42)20-10-8-9-11-32(27-12-16-30(39)17-13-27)28-14-18-31(40)19-15-28/h12-19,25-26,32H,8-11,20-24H2,1-7H3 |
| InChIKey | DQYMRJZVWUVEHQ-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|