About 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone
1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone (PubChem CID 104613073) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone |
| PubChem CID | 104613073 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone |
| SMILES | CCC1(CC)CC(Nc2ccc(N)c(C(C)=O)c2)CCO1 |
| InChI | InChI=1S/C17H26N2O2/c1-4-17(5-2)11-14(8-9-21-17)19-13-6-7-16(18)15(10-13)12(3)20/h6-7,10,14,19H,4-5,8-9,11,18H2,1-3H3 |
| InChIKey | FULRVHYMFXJMQD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone?
The IUPAC name of 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone (CID 104613073) is 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone.
What is the SMILES notation for 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone?
The canonical SMILES for 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone is CCC1(CC)CC(Nc2ccc(N)c(C(C)=O)c2)CCO1.
What is the InChIKey of 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone?
The InChIKey is FULRVHYMFXJMQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2/c1-4-17(5-2)11-14(8-9-21-17)19-13-6-7-16(18)15(10-13)12(3)20/h6-7,10,14,19H,4-5,8-9,11,18H2,1-3H3.
What are the key properties of 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone?
1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone has a molecular weight of 290.41 g/mol, XLogP of 3.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-amino-5-[(2,2-diethyloxan-4-yl)amino]phenyl]ethanone is sourced from PubChem (CID 104613073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).