C35H33F3O6 — CID 10461309
[(8R,9S,13R,14S,16R,17R)-3-acetyloxy-16-benzoyloxy-13-(trifluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methyl benzoate (PubChem CID 10461309) has the molecular formula C35H33F3O6 and a molecular weight of 606.64 g/mol. Its IUPAC name is [(8R,9S,13R,14S,16R,17R)-3-acetyloxy-16-benzoyloxy-13-(trifluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methyl benzoate.
| Compound Name | [(8R,9S,13R,14S,16R,17R)-3-acetyloxy-16-benzoyloxy-13-(trifluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methyl benzoate |
|---|---|
| PubChem CID | 10461309 |
| Molecular Formula | C35H33F3O6 |
| Molecular Weight | 606.64 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | [(8R,9S,13R,14S,16R,17R)-3-acetyloxy-16-benzoyloxy-13-(trifluoromethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]methyl benzoate |
| SMILES | CC(=O)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C(F)(F)F)[C@H](COC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C35H33F3O6/c1-21(39)43-25-13-15-26-24(18-25)12-14-28-27(26)16-17-34(35(36,37)38)29(28)19-31(44-33(41)23-10-6-3-7-11-23)30(34)20-42-32(40)22-8-4-2-5-9-22/h2-11,13,15,18,27-31H,12,14,16-17,19-20H2,1H3/t27-,28-,29+,30-,31-,34-/m1/s1 |
| InChIKey | MMNXIGYSLIRHKT-FRALSVSPSA-N |
| XLogP | 7.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.64 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|