C14H18N2O4 — CID 104613551
1-[5-(3,3-dimethylmorpholin-4-yl)-2-nitrophenyl]ethanone (PubChem CID 104613551) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1-[5-(3,3-dimethylmorpholin-4-yl)-2-nitrophenyl]ethanone.
| Compound Name | 1-[5-(3,3-dimethylmorpholin-4-yl)-2-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 104613551 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-[5-(3,3-dimethylmorpholin-4-yl)-2-nitrophenyl]ethanone |
| SMILES | CC(=O)c1cc(N2CCOCC2(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N2O4/c1-10(17)12-8-11(4-5-13(12)16(18)19)15-6-7-20-9-14(15,2)3/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | DYRLLGAUPWFVEN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|