C12H17N3O — CID 104614467
N-propyl-1,2,3,4-tetrahydroquinoxaline-5-carboxamide (PubChem CID 104614467) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is N-propyl-1,2,3,4-tetrahydroquinoxaline-5-carboxamide.
| Compound Name | N-propyl-1,2,3,4-tetrahydroquinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 104614467 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-propyl-1,2,3,4-tetrahydroquinoxaline-5-carboxamide |
| SMILES | CCCNC(=O)c1cccc2c1NCCN2 |
| InChI | InChI=1S/C12H17N3O/c1-2-6-15-12(16)9-4-3-5-10-11(9)14-8-7-13-10/h3-5,13-14H,2,6-8H2,1H3,(H,15,16) |
| InChIKey | SKQWJKSKALUJBL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |