C25H30Cl4O9 — CID 10461476
methyl (1R,2R,6R,8S,9R,13S,14R,15R,16S,17S)-15,16-bis[(2,2-dichloroacetyl)oxy]-4-hydroxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-10-ene-17-carboxylate (PubChem CID 10461476) has the molecular formula C25H30Cl4O9 and a molecular weight of 616.32 g/mol. Its IUPAC name is methyl (1R,2R,6R,8S,9R,13S,14R,15R,16S,17S)-15,16-bis[(2,2-dichloroacetyl)oxy]-4-hydroxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-10-ene-17-carboxylate.
| Compound Name | methyl (1R,2R,6R,8S,9R,13S,14R,15R,16S,17S)-15,16-bis[(2,2-dichloroacetyl)oxy]-4-hydroxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-10-ene-17-carboxylate |
|---|---|
| PubChem CID | 10461476 |
| Molecular Formula | C25H30Cl4O9 |
| Molecular Weight | 616.32 g/mol |
| Exact Mass | 614.06 |
| IUPAC Name | methyl (1R,2R,6R,8S,9R,13S,14R,15R,16S,17S)-15,16-bis[(2,2-dichloroacetyl)oxy]-4-hydroxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-10-ene-17-carboxylate |
| SMILES | COC(=O)[C@@]12OC[C@]34[C@H]([C@@H](OC(=O)C(Cl)Cl)[C@@H]1OC(=O)C(Cl)Cl)[C@@]1(C)CC=C[C@@H](C)[C@@H]1C[C@H]3OC(O)C[C@@H]24 |
| InChI | InChI=1S/C25H30Cl4O9/c1-10-5-4-6-23(2)11(10)7-13-24-9-35-25(22(33)34-3,12(24)8-14(30)36-13)17(38-21(32)19(28)29)15(16(23)24)37-20(31)18(26)27/h4-5,10-19,30H,6-9H2,1-3H3/t10-,11+,12-,13-,14?,15-,16-,17+,23+,24-,25+/m1/s1 |
| InChIKey | PLUBHLJCLWLVJZ-CGWXGXRWSA-N |
| XLogP | 3.32 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|